C20H18N2O5 — CID 123359285
4-[4-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methylamino]phenyl]benzamide (PubChem CID 123359285) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is 4-[4-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methylamino]phenyl]benzamide.
| Compound Name | 4-[4-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 123359285 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-[4-[[3-hydroxy-6-(hydroxymethyl)-4-oxopyran-2-yl]methylamino]phenyl]benzamide |
| SMILES | NC(=O)c1ccc(-c2ccc(NCc3oc(CO)cc(=O)c3O)cc2)cc1 |
| InChI | InChI=1S/C20H18N2O5/c21-20(26)14-3-1-12(2-4-14)13-5-7-15(8-6-13)22-10-18-19(25)17(24)9-16(11-23)27-18/h1-9,22-23,25H,10-11H2,(H2,21,26) |
| InChIKey | PYHOGFUQMBBJQO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |