C23H23N5O2S — CID 123359841
3-[4-[7-amino-2-(2,3-dihydro-1,2-benzothiazol-7-yl)furo[2,3-c]pyridin-4-yl]pyrazol-1-yl]cyclohexan-1-ol (PubChem CID 123359841) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is 3-[4-[7-amino-2-(2,3-dihydro-1,2-benzothiazol-7-yl)furo[2,3-c]pyridin-4-yl]pyrazol-1-yl]cyclohexan-1-ol.
| Compound Name | 3-[4-[7-amino-2-(2,3-dihydro-1,2-benzothiazol-7-yl)furo[2,3-c]pyridin-4-yl]pyrazol-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 123359841 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 3-[4-[7-amino-2-(2,3-dihydro-1,2-benzothiazol-7-yl)furo[2,3-c]pyridin-4-yl]pyrazol-1-yl]cyclohexan-1-ol |
| SMILES | Nc1ncc(-c2cnn(C3CCCC(O)C3)c2)c2cc(-c3cccc4c3SNC4)oc12 |
| InChI | InChI=1S/C23H23N5O2S/c24-23-21-18(8-20(30-21)17-6-1-3-13-10-27-31-22(13)17)19(11-25-23)14-9-26-28(12-14)15-4-2-5-16(29)7-15/h1,3,6,8-9,11-12,15-16,27,29H,2,4-5,7,10H2,(H2,24,25) |
| InChIKey | OONFRYLZRPDXTD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|