C48H49FN4 — CID 123360159
2-[[8-[1-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)prop-1-en-2-yl]naphthalen-2-yl]methyl]-5-[2-(4-fluorophenyl)propyl]-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 123360159) has the molecular formula C48H49FN4 and a molecular weight of 700.95 g/mol. Its IUPAC name is 2-[[8-[1-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)prop-1-en-2-yl]naphthalen-2-yl]methyl]-5-[2-(4-fluorophenyl)propyl]-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 2-[[8-[1-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)prop-1-en-2-yl]naphthalen-2-yl]methyl]-5-[2-(4-fluorophenyl)propyl]-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 123360159 |
| Molecular Formula | C48H49FN4 |
| Molecular Weight | 700.95 g/mol |
| Exact Mass | 700.39 |
| IUPAC Name | 2-[[8-[1-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)prop-1-en-2-yl]naphthalen-2-yl]methyl]-5-[2-(4-fluorophenyl)propyl]-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | CC(=Cn1c2c(c3cc(C)ccc31)CN(C)CC2)c1cccc2ccc(CN3CCc4c(c5cc(C)ccc5n4CC(C)c4ccc(F)cc4)C3)cc12 |
| InChI | InChI=1S/C48H49FN4/c1-31-9-17-45-41(23-31)43-29-50(5)21-19-47(43)53(45)27-34(4)39-8-6-7-37-12-11-35(25-40(37)39)28-51-22-20-48-44(30-51)42-24-32(2)10-18-46(42)52(48)26-33(3)36-13-15-38(49)16-14-36/h6-18,23-25,27,33H,19-22,26,28-30H2,1-5H3 |
| InChIKey | BNBXYHYSPCLKIO-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 16.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.95 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|