C25H22N2O — CID 123361799
5-[4-[4-(4-methylphenyl)phenyl]phenoxy]benzene-1,3-diamine (PubChem CID 123361799) has the molecular formula C25H22N2O and a molecular weight of 366.46 g/mol. Its IUPAC name is 5-[4-[4-(4-methylphenyl)phenyl]phenoxy]benzene-1,3-diamine.
| Compound Name | 5-[4-[4-(4-methylphenyl)phenyl]phenoxy]benzene-1,3-diamine |
|---|---|
| PubChem CID | 123361799 |
| Molecular Formula | C25H22N2O |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 5-[4-[4-(4-methylphenyl)phenyl]phenoxy]benzene-1,3-diamine |
| SMILES | Cc1ccc(-c2ccc(-c3ccc(Oc4cc(N)cc(N)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H22N2O/c1-17-2-4-18(5-3-17)19-6-8-20(9-7-19)21-10-12-24(13-11-21)28-25-15-22(26)14-23(27)16-25/h2-16H,26-27H2,1H3 |
| InChIKey | WUOBJPFZDJKOKQ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|