C10H10O3 — CID 123362321
5,6-dimethoxycyclohepta-1,3,4,6-tetraene-1-carbaldehyde (PubChem CID 123362321) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 5,6-dimethoxycyclohepta-1,3,4,6-tetraene-1-carbaldehyde.
| Compound Name | 5,6-dimethoxycyclohepta-1,3,4,6-tetraene-1-carbaldehyde |
|---|---|
| PubChem CID | 123362321 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 5,6-dimethoxycyclohepta-1,3,4,6-tetraene-1-carbaldehyde |
| SMILES | COC1=C=CC=C(C=O)C=C1OC |
| InChI | InChI=1S/C10H10O3/c1-12-9-5-3-4-8(7-11)6-10(9)13-2/h3-4,6-7H,1-2H3 |
| InChIKey | JRNZYESRKKARGS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|