C10H11FO3 — CID 143712837
7-fluoro-3,4-dimethoxycyclohepta-1,3,6-triene-1-carbaldehyde (PubChem CID 143712837) has the molecular formula C10H11FO3 and a molecular weight of 198.19 g/mol. Its IUPAC name is 7-fluoro-3,4-dimethoxycyclohepta-1,3,6-triene-1-carbaldehyde.
| Compound Name | 7-fluoro-3,4-dimethoxycyclohepta-1,3,6-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 143712837 |
| Molecular Formula | C10H11FO3 |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 7-fluoro-3,4-dimethoxycyclohepta-1,3,6-triene-1-carbaldehyde |
| SMILES | COC1=C(OC)CC=C(F)C(C=O)=C1 |
| InChI | InChI=1S/C10H11FO3/c1-13-9-4-3-8(11)7(6-12)5-10(9)14-2/h3,5-6H,4H2,1-2H3 |
| InChIKey | IPZOJWKXAQWWGP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|