C10H9F3O2 — CID 142176181
2-methoxy-4-(trifluoromethyl)cyclohepta-1,3,6-triene-1-carbaldehyde (PubChem CID 142176181) has the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. Its IUPAC name is 2-methoxy-4-(trifluoromethyl)cyclohepta-1,3,6-triene-1-carbaldehyde.
| Compound Name | 2-methoxy-4-(trifluoromethyl)cyclohepta-1,3,6-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 142176181 |
| Molecular Formula | C10H9F3O2 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 2-methoxy-4-(trifluoromethyl)cyclohepta-1,3,6-triene-1-carbaldehyde |
| SMILES | COC1=C(C=O)C=CCC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C10H9F3O2/c1-15-9-5-8(10(11,12)13)4-2-3-7(9)6-14/h2-3,5-6H,4H2,1H3 |
| InChIKey | SRCOOZAPUDUHIO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|