C12H13FO2 — CID 143545325
4-(1-ethoxyethenyl)-3-fluorocyclohepta-1,3,6-triene-1-carbaldehyde (PubChem CID 143545325) has the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. Its IUPAC name is 4-(1-ethoxyethenyl)-3-fluorocyclohepta-1,3,6-triene-1-carbaldehyde.
| Compound Name | 4-(1-ethoxyethenyl)-3-fluorocyclohepta-1,3,6-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 143545325 |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 4-(1-ethoxyethenyl)-3-fluorocyclohepta-1,3,6-triene-1-carbaldehyde |
| SMILES | C=C(OCC)C1=C(F)C=C(C=O)C=CC1 |
| InChI | InChI=1S/C12H13FO2/c1-3-15-9(2)11-6-4-5-10(8-14)7-12(11)13/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | YGJSWWZSZNXUQF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|