C9H9F3O2 — CID 143962385
(3E)-5-methoxy-2-methylidene-4-(trifluoromethyl)hexa-3,5-dienal (PubChem CID 143962385) has the molecular formula C9H9F3O2 and a molecular weight of 206.16 g/mol. Its IUPAC name is (3E)-5-methoxy-2-methylidene-4-(trifluoromethyl)hexa-3,5-dienal.
| Compound Name | (3E)-5-methoxy-2-methylidene-4-(trifluoromethyl)hexa-3,5-dienal |
|---|---|
| PubChem CID | 143962385 |
| Molecular Formula | C9H9F3O2 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | (3E)-5-methoxy-2-methylidene-4-(trifluoromethyl)hexa-3,5-dienal |
| SMILES | C=C(C=O)/C=C(\C(=C)OC)C(F)(F)F |
| InChI | InChI=1S/C9H9F3O2/c1-6(5-13)4-8(7(2)14-3)9(10,11)12/h4-5H,1-2H2,3H3/b8-4+ |
| InChIKey | PASPYKFRAVTKIT-XBXARRHUSA-N |
| XLogP | 2.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|