C27H24ClN3O5 — CID 123362492
4-[4-[6-chloro-2-[(3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)oxy]-1H-benzimidazol-5-yl]phenyl]-N-methylbenzamide (PubChem CID 123362492) has the molecular formula C27H24ClN3O5 and a molecular weight of 505.96 g/mol. Its IUPAC name is 4-[4-[6-chloro-2-[(3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)oxy]-1H-benzimidazol-5-yl]phenyl]-N-methylbenzamide.
| Compound Name | 4-[4-[6-chloro-2-[(3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)oxy]-1H-benzimidazol-5-yl]phenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 123362492 |
| Molecular Formula | C27H24ClN3O5 |
| Molecular Weight | 505.96 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 4-[4-[6-chloro-2-[(3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)oxy]-1H-benzimidazol-5-yl]phenyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(-c2ccc(-c3cc4nc(OC5COC6C(O)COC56)[nH]c4cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C27H24ClN3O5/c1-29-26(33)17-8-4-15(5-9-17)14-2-6-16(7-3-14)18-10-20-21(11-19(18)28)31-27(30-20)36-23-13-35-24-22(32)12-34-25(23)24/h2-11,22-25,32H,12-13H2,1H3,(H,29,33)(H,30,31) |
| InChIKey | RTOYIQZCEADLHH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 105.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.96 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |