C21H30FNO3S — CID 123362697
N-[1-[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]propylidene]-2-methylpropane-2-sulfinamide (PubChem CID 123362697) has the molecular formula C21H30FNO3S and a molecular weight of 395.54 g/mol. Its IUPAC name is N-[1-[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]propylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[1-[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]propylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 123362697 |
| Molecular Formula | C21H30FNO3S |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-[1-[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]propylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CCC(=NS(=O)C(C)(C)C)C1(c2ccc(F)cc2)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C21H30FNO3S/c1-5-18(23-27(24)19(2,3)4)20(16-6-8-17(22)9-7-16)10-12-21(13-11-20)25-14-15-26-21/h6-9H,5,10-15H2,1-4H3 |
| InChIKey | PWXVEUFTZUGARV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|