C6H7F2NO2 — CID 123363913
1-(2,2-difluoroethyl)pyrrole-2,5-diol (PubChem CID 123363913) has the molecular formula C6H7F2NO2 and a molecular weight of 163.12 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)pyrrole-2,5-diol.
| Compound Name | 1-(2,2-difluoroethyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 123363913 |
| Molecular Formula | C6H7F2NO2 |
| Molecular Weight | 163.12 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 1-(2,2-difluoroethyl)pyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1CC(F)F |
| InChI | InChI=1S/C6H7F2NO2/c7-4(8)3-9-5(10)1-2-6(9)11/h1-2,4,10-11H,3H2 |
| InChIKey | ZSXOZWMIZKHYQU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.12 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |