C30H29N3O4S — CID 123364845
3-[ethyl-[4-[2-(6-methoxy-3-pyridinyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]-4-phenylhex-5-enoic acid (PubChem CID 123364845) has the molecular formula C30H29N3O4S and a molecular weight of 527.65 g/mol. Its IUPAC name is 3-[ethyl-[4-[2-(6-methoxy-3-pyridinyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]-4-phenylhex-5-enoic acid.
| Compound Name | 3-[ethyl-[4-[2-(6-methoxy-3-pyridinyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]-4-phenylhex-5-enoic acid |
|---|---|
| PubChem CID | 123364845 |
| Molecular Formula | C30H29N3O4S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 3-[ethyl-[4-[2-(6-methoxy-3-pyridinyl)phenyl]-1,3-thiazol-2-yl]carbamoyl]-4-phenylhex-5-enoic acid |
| SMILES | C=CC(c1ccccc1)C(CC(=O)O)C(=O)N(CC)c1nc(-c2ccccc2-c2ccc(OC)nc2)cs1 |
| InChI | InChI=1S/C30H29N3O4S/c1-4-22(20-11-7-6-8-12-20)25(17-28(34)35)29(36)33(5-2)30-32-26(19-38-30)24-14-10-9-13-23(24)21-15-16-27(37-3)31-18-21/h4,6-16,18-19,22,25H,1,5,17H2,2-3H3,(H,34,35) |
| InChIKey | KFRZUDCEJKSTEE-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|