C29H29N3O5S — CID 67209870
3-benzyl-4-[[4-[2-[6-(2-methoxyethoxy)-3-pyridinyl]phenyl]-1,3-thiazol-2-yl]-methylamino]-4-oxobutanoic acid (PubChem CID 67209870) has the molecular formula C29H29N3O5S and a molecular weight of 531.63 g/mol. Its IUPAC name is 3-benzyl-4-[[4-[2-[6-(2-methoxyethoxy)-3-pyridinyl]phenyl]-1,3-thiazol-2-yl]-methylamino]-4-oxobutanoic acid.
| Compound Name | 3-benzyl-4-[[4-[2-[6-(2-methoxyethoxy)-3-pyridinyl]phenyl]-1,3-thiazol-2-yl]-methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67209870 |
| Molecular Formula | C29H29N3O5S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 3-benzyl-4-[[4-[2-[6-(2-methoxyethoxy)-3-pyridinyl]phenyl]-1,3-thiazol-2-yl]-methylamino]-4-oxobutanoic acid |
| SMILES | COCCOc1ccc(-c2ccccc2-c2csc(N(C)C(=O)C(CC(=O)O)Cc3ccccc3)n2)cn1 |
| InChI | InChI=1S/C29H29N3O5S/c1-32(28(35)22(17-27(33)34)16-20-8-4-3-5-9-20)29-31-25(19-38-29)24-11-7-6-10-23(24)21-12-13-26(30-18-21)37-15-14-36-2/h3-13,18-19,22H,14-17H2,1-2H3,(H,33,34) |
| InChIKey | ZOOZKFDABLEUJQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|