C21H17Cl3N2O3S — CID 67210017
3-benzyl-4-[methyl-[4-(2,3,5-trichlorophenyl)-1,3-thiazol-2-yl]amino]-4-oxobutanoic acid (PubChem CID 67210017) has the molecular formula C21H17Cl3N2O3S and a molecular weight of 483.80 g/mol. Its IUPAC name is 3-benzyl-4-[methyl-[4-(2,3,5-trichlorophenyl)-1,3-thiazol-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-benzyl-4-[methyl-[4-(2,3,5-trichlorophenyl)-1,3-thiazol-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67210017 |
| Molecular Formula | C21H17Cl3N2O3S |
| Molecular Weight | 483.80 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | 3-benzyl-4-[methyl-[4-(2,3,5-trichlorophenyl)-1,3-thiazol-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CN(C(=O)C(CC(=O)O)Cc1ccccc1)c1nc(-c2cc(Cl)cc(Cl)c2Cl)cs1 |
| InChI | InChI=1S/C21H17Cl3N2O3S/c1-26(20(29)13(8-18(27)28)7-12-5-3-2-4-6-12)21-25-17(11-30-21)15-9-14(22)10-16(23)19(15)24/h2-6,9-11,13H,7-8H2,1H3,(H,27,28) |
| InChIKey | JOUWYLLGJWRVKS-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.80 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|