About (2-bromo-1,1-dicyclohexylethoxy)silane
(2-bromo-1,1-dicyclohexylethoxy)silane (PubChem CID 123366648) has the molecular formula C14H27BrOSi
and a molecular weight of 319.36 g/mol. Its IUPAC name is (2-bromo-1,1-dicyclohexylethoxy)silane.
Molecular Properties
| Compound Name | (2-bromo-1,1-dicyclohexylethoxy)silane |
| PubChem CID | 123366648 |
| Molecular Formula | C14H27BrOSi |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (2-bromo-1,1-dicyclohexylethoxy)silane |
| SMILES | [SiH3]OC(CBr)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C14H27BrOSi/c15-11-14(16-17,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h12-13H,1-11H2,17H3 |
| InChIKey | XIYRAGMDSXRZDY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-1,1-dicyclohexylethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-1,1-dicyclohexylethoxy)silane?
The IUPAC name of (2-bromo-1,1-dicyclohexylethoxy)silane (CID 123366648) is (2-bromo-1,1-dicyclohexylethoxy)silane.
What is the SMILES notation for (2-bromo-1,1-dicyclohexylethoxy)silane?
The canonical SMILES for (2-bromo-1,1-dicyclohexylethoxy)silane is [SiH3]OC(CBr)(C1CCCCC1)C1CCCCC1.
What is the InChIKey of (2-bromo-1,1-dicyclohexylethoxy)silane?
The InChIKey is XIYRAGMDSXRZDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27BrOSi/c15-11-14(16-17,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h12-13H,1-11H2,17H3.
What are the key properties of (2-bromo-1,1-dicyclohexylethoxy)silane?
(2-bromo-1,1-dicyclohexylethoxy)silane has a molecular weight of 319.36 g/mol, XLogP of 3.58, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-1,1-dicyclohexylethoxy)silane is sourced from PubChem (CID 123366648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).