C10H22O3Si — CID 175185945
(2-cyclohexyl-2,2-dimethoxyethoxy)silane (PubChem CID 175185945) has the molecular formula C10H22O3Si and a molecular weight of 218.37 g/mol. Its IUPAC name is (2-cyclohexyl-2,2-dimethoxyethoxy)silane.
| Compound Name | (2-cyclohexyl-2,2-dimethoxyethoxy)silane |
|---|---|
| PubChem CID | 175185945 |
| Molecular Formula | C10H22O3Si |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (2-cyclohexyl-2,2-dimethoxyethoxy)silane |
| SMILES | COC(CO[SiH3])(OC)C1CCCCC1 |
| InChI | InChI=1S/C10H22O3Si/c1-11-10(12-2,8-13-14)9-6-4-3-5-7-9/h9H,3-8H2,1-2,14H3 |
| InChIKey | IRGQDBFMENCGLI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|