About (2-cyclohexyl-1,3-dimethoxybutan-2-yl)cyclohexane
(2-cyclohexyl-1,3-dimethoxybutan-2-yl)cyclohexane (PubChem CID 66896613) has the molecular formula C18H34O2
and a molecular weight of 282.47 g/mol. Its IUPAC name is (2-cyclohexyl-1,3-dimethoxybutan-2-yl)cyclohexane.
Molecular Properties
| Compound Name | (2-cyclohexyl-1,3-dimethoxybutan-2-yl)cyclohexane |
| PubChem CID | 66896613 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | (2-cyclohexyl-1,3-dimethoxybutan-2-yl)cyclohexane |
| SMILES | COCC(C1CCCCC1)(C1CCCCC1)C(C)OC |
| InChI | InChI=1S/C18H34O2/c1-15(20-3)18(14-19-2,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h15-17H,4-14H2,1-3H3 |
| InChIKey | UQPREOUZEIKSCT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-cyclohexyl-1,3-dimethoxybutan-2-yl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclohexyl-1,3-dimethoxybutan-2-yl)cyclohexane?
The IUPAC name of (2-cyclohexyl-1,3-dimethoxybutan-2-yl)cyclohexane (CID 66896613) is (2-cyclohexyl-1,3-dimethoxybutan-2-yl)cyclohexane.
What is the SMILES notation for (2-cyclohexyl-1,3-dimethoxybutan-2-yl)cyclohexane?
The canonical SMILES for (2-cyclohexyl-1,3-dimethoxybutan-2-yl)cyclohexane is COCC(C1CCCCC1)(C1CCCCC1)C(C)OC.
What is the InChIKey of (2-cyclohexyl-1,3-dimethoxybutan-2-yl)cyclohexane?
The InChIKey is UQPREOUZEIKSCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2/c1-15(20-3)18(14-19-2,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h15-17H,4-14H2,1-3H3.
What are the key properties of (2-cyclohexyl-1,3-dimethoxybutan-2-yl)cyclohexane?
(2-cyclohexyl-1,3-dimethoxybutan-2-yl)cyclohexane has a molecular weight of 282.47 g/mol, XLogP of 4.81, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclohexyl-1,3-dimethoxybutan-2-yl)cyclohexane is sourced from PubChem (CID 66896613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).