C9H11Cl2NS — CID 123367886
2-(3,5-dichloro-4-methylcyclohex-3-en-1-yl)-2-iminoethanethial (PubChem CID 123367886) has the molecular formula C9H11Cl2NS and a molecular weight of 236.17 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-methylcyclohex-3-en-1-yl)-2-iminoethanethial.
| Compound Name | 2-(3,5-dichloro-4-methylcyclohex-3-en-1-yl)-2-iminoethanethial |
|---|---|
| PubChem CID | 123367886 |
| Molecular Formula | C9H11Cl2NS |
| Molecular Weight | 236.17 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 2-(3,5-dichloro-4-methylcyclohex-3-en-1-yl)-2-iminoethanethial |
| SMILES | [H]/N=C(\C=S)C1CC(Cl)=C(C)C(Cl)C1 |
| InChI | InChI=1S/C9H11Cl2NS/c1-5-7(10)2-6(3-8(5)11)9(12)4-13/h4,6-7,12H,2-3H2,1H3/b12-9+ |
| InChIKey | ZUJHJEDLJIOPPS-FMIVXFBMSA-N |
| XLogP | 3.54 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.17 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|