C8H9Cl2NS — CID 123814628
2-(3,4-dichlorocyclohex-3-en-1-yl)-2-iminoethanethial (PubChem CID 123814628) has the molecular formula C8H9Cl2NS and a molecular weight of 222.14 g/mol. Its IUPAC name is 2-(3,4-dichlorocyclohex-3-en-1-yl)-2-iminoethanethial.
| Compound Name | 2-(3,4-dichlorocyclohex-3-en-1-yl)-2-iminoethanethial |
|---|---|
| PubChem CID | 123814628 |
| Molecular Formula | C8H9Cl2NS |
| Molecular Weight | 222.14 g/mol |
| Exact Mass | 220.98 |
| IUPAC Name | 2-(3,4-dichlorocyclohex-3-en-1-yl)-2-iminoethanethial |
| SMILES | [H]/N=C(\C=S)C1CCC(Cl)=C(Cl)C1 |
| InChI | InChI=1S/C8H9Cl2NS/c9-6-2-1-5(3-7(6)10)8(11)4-12/h4-5,11H,1-3H2/b11-8+ |
| InChIKey | TVIYSBMMECMLSC-DHZHZOJOSA-N |
| XLogP | 3.50 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.14 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|