C9H9ClF3NS — CID 123473065
2-[4-chloro-5-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial (PubChem CID 123473065) has the molecular formula C9H9ClF3NS and a molecular weight of 255.69 g/mol. Its IUPAC name is 2-[4-chloro-5-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial.
| Compound Name | 2-[4-chloro-5-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial |
|---|---|
| PubChem CID | 123473065 |
| Molecular Formula | C9H9ClF3NS |
| Molecular Weight | 255.69 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 2-[4-chloro-5-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial |
| SMILES | [H]/N=C(\C=S)C1CC=C(Cl)C(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H9ClF3NS/c10-7-2-1-5(8(14)4-15)3-6(7)9(11,12)13/h2,4-6,14H,1,3H2/b14-8+ |
| InChIKey | RROYHBPSJYWQFC-RIYZIHGNSA-N |
| XLogP | 3.72 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|