C9H8F5NS — CID 123181672
2-[5,6-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial (PubChem CID 123181672) has the molecular formula C9H8F5NS and a molecular weight of 257.23 g/mol. Its IUPAC name is 2-[5,6-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial.
| Compound Name | 2-[5,6-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial |
|---|---|
| PubChem CID | 123181672 |
| Molecular Formula | C9H8F5NS |
| Molecular Weight | 257.23 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2-[5,6-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial |
| SMILES | [H]/N=C(\C=S)C1CC=C(C(F)(F)F)C(F)C1F |
| InChI | InChI=1S/C9H8F5NS/c10-7-4(6(15)3-16)1-2-5(8(7)11)9(12,13)14/h2-4,7-8,15H,1H2/b15-6+ |
| InChIKey | LCKWDKSFGBWUBS-GIDUJCDVSA-N |
| XLogP | 3.19 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|