C9H10F3NS — CID 123147005
2-imino-2-[3-(trifluoromethyl)cyclohex-3-en-1-yl]ethanethial (PubChem CID 123147005) has the molecular formula C9H10F3NS and a molecular weight of 221.25 g/mol. Its IUPAC name is 2-imino-2-[3-(trifluoromethyl)cyclohex-3-en-1-yl]ethanethial.
| Compound Name | 2-imino-2-[3-(trifluoromethyl)cyclohex-3-en-1-yl]ethanethial |
|---|---|
| PubChem CID | 123147005 |
| Molecular Formula | C9H10F3NS |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 2-imino-2-[3-(trifluoromethyl)cyclohex-3-en-1-yl]ethanethial |
| SMILES | [H]/N=C(\C=S)C1CCC=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H10F3NS/c10-9(11,12)7-3-1-2-6(4-7)8(13)5-14/h3,5-6,13H,1-2,4H2/b13-8+ |
| InChIKey | VDTASHAROZTRCL-MDWZMJQESA-N |
| XLogP | 3.29 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|