C9H9F4NS — CID 123151686
2-[6-fluoro-3-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial (PubChem CID 123151686) has the molecular formula C9H9F4NS and a molecular weight of 239.24 g/mol. Its IUPAC name is 2-[6-fluoro-3-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial.
| Compound Name | 2-[6-fluoro-3-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial |
|---|---|
| PubChem CID | 123151686 |
| Molecular Formula | C9H9F4NS |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 2-[6-fluoro-3-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial |
| SMILES | [H]/N=C(\C=S)C1CC(C(F)(F)F)=CCC1F |
| InChI | InChI=1S/C9H9F4NS/c10-7-2-1-5(9(11,12)13)3-6(7)8(14)4-15/h1,4,6-7,14H,2-3H2/b14-8+ |
| InChIKey | SDKGZMUSUSNFFI-RIYZIHGNSA-N |
| XLogP | 3.24 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|