C8H9F2NS — CID 123307784
2-(5,6-difluorocyclohex-3-en-1-yl)-2-iminoethanethial (PubChem CID 123307784) has the molecular formula C8H9F2NS and a molecular weight of 189.23 g/mol. Its IUPAC name is 2-(5,6-difluorocyclohex-3-en-1-yl)-2-iminoethanethial.
| Compound Name | 2-(5,6-difluorocyclohex-3-en-1-yl)-2-iminoethanethial |
|---|---|
| PubChem CID | 123307784 |
| Molecular Formula | C8H9F2NS |
| Molecular Weight | 189.23 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 2-(5,6-difluorocyclohex-3-en-1-yl)-2-iminoethanethial |
| SMILES | [H]/N=C(\C=S)C1CC=CC(F)C1F |
| InChI | InChI=1S/C8H9F2NS/c9-6-3-1-2-5(8(6)10)7(11)4-12/h1,3-6,8,11H,2H2/b11-7+ |
| InChIKey | QUFIQBFPKBTKCN-YRNVUSSQSA-N |
| XLogP | 2.26 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|