C11H17NO — CID 123368066
N-ethyl-N-hepta-1,3,5-trien-3-ylacetamide (PubChem CID 123368066) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N-ethyl-N-hepta-1,3,5-trien-3-ylacetamide.
| Compound Name | N-ethyl-N-hepta-1,3,5-trien-3-ylacetamide |
|---|---|
| PubChem CID | 123368066 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-ethyl-N-hepta-1,3,5-trien-3-ylacetamide |
| SMILES | C=CC(=CC=CC)N(CC)C(C)=O |
| InChI | InChI=1S/C11H17NO/c1-5-8-9-11(6-2)12(7-3)10(4)13/h5-6,8-9H,2,7H2,1,3-4H3 |
| InChIKey | SZCUQRAGKQIXIP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|