C9H11N3S — CID 123370938
2-(2-methyl-1,4-dihydropyrimidin-6-yl)but-3-ynethioamide (PubChem CID 123370938) has the molecular formula C9H11N3S and a molecular weight of 193.27 g/mol. Its IUPAC name is 2-(2-methyl-1,4-dihydropyrimidin-6-yl)but-3-ynethioamide.
| Compound Name | 2-(2-methyl-1,4-dihydropyrimidin-6-yl)but-3-ynethioamide |
|---|---|
| PubChem CID | 123370938 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-(2-methyl-1,4-dihydropyrimidin-6-yl)but-3-ynethioamide |
| SMILES | C#CC(C(N)=S)C1=CCN=C(C)N1 |
| InChI | InChI=1S/C9H11N3S/c1-3-7(9(10)13)8-4-5-11-6(2)12-8/h1,4,7H,5H2,2H3,(H2,10,13)(H,11,12) |
| InChIKey | WXIXHLUYZYXVQX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|