C8H13N3S — CID 123182298
2-(2-methyl-1,4-dihydropyrimidin-6-yl)propanethioamide (PubChem CID 123182298) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is 2-(2-methyl-1,4-dihydropyrimidin-6-yl)propanethioamide.
| Compound Name | 2-(2-methyl-1,4-dihydropyrimidin-6-yl)propanethioamide |
|---|---|
| PubChem CID | 123182298 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 2-(2-methyl-1,4-dihydropyrimidin-6-yl)propanethioamide |
| SMILES | CC1=NCC=C(C(C)C(N)=S)N1 |
| InChI | InChI=1S/C8H13N3S/c1-5(8(9)12)7-3-4-10-6(2)11-7/h3,5H,4H2,1-2H3,(H2,9,12)(H,10,11) |
| InChIKey | FUDLQUDUKRTYMS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|