C23H30N2O4 — CID 123371173
4a,7-dihydroxy-N-methyl-3-(3-methylbut-2-enyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide (PubChem CID 123371173) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 4a,7-dihydroxy-N-methyl-3-(3-methylbut-2-enyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide.
| Compound Name | 4a,7-dihydroxy-N-methyl-3-(3-methylbut-2-enyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide |
|---|---|
| PubChem CID | 123371173 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 4a,7-dihydroxy-N-methyl-3-(3-methylbut-2-enyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-9-carboxamide |
| SMILES | CNC(=O)c1ccc2c3c1OC1C(O)CCC4(O)C(C2)N(CC=C(C)C)CCC314 |
| InChI | InChI=1S/C23H30N2O4/c1-13(2)7-10-25-11-9-22-18-14-4-5-15(21(27)24-3)19(18)29-20(22)16(26)6-8-23(22,28)17(25)12-14/h4-5,7,16-17,20,26,28H,6,8-12H2,1-3H3,(H,24,27) |
| InChIKey | OZQLQDCEHRZVAS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|