C13H17NO4S — CID 123371243
ethyl 1-formyl-4-hydroxy-4-(1,3-thiazol-2-yl)cyclohexane-1-carboxylate (PubChem CID 123371243) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is ethyl 1-formyl-4-hydroxy-4-(1,3-thiazol-2-yl)cyclohexane-1-carboxylate.
| Compound Name | ethyl 1-formyl-4-hydroxy-4-(1,3-thiazol-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 123371243 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | ethyl 1-formyl-4-hydroxy-4-(1,3-thiazol-2-yl)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(C=O)CCC(O)(c2nccs2)CC1 |
| InChI | InChI=1S/C13H17NO4S/c1-2-18-11(16)12(9-15)3-5-13(17,6-4-12)10-14-7-8-19-10/h7-9,17H,2-6H2,1H3 |
| InChIKey | JDDSIKBAGPMQHE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|