C28H26ClF2N5O4 — CID 123374240
3-acetyl-1-[2-[(2S,4R)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-fluoropyrrolidin-1-yl]-2-oxoethyl]-N-ethoxyindole-6-carboximidoyl cyanide (PubChem CID 123374240) has the molecular formula C28H26ClF2N5O4 and a molecular weight of 570.00 g/mol. Its IUPAC name is 3-acetyl-1-[2-[(2S,4R)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-fluoropyrrolidin-1-yl]-2-oxoethyl]-N-ethoxyindole-6-carboximidoyl cyanide.
| Compound Name | 3-acetyl-1-[2-[(2S,4R)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-fluoropyrrolidin-1-yl]-2-oxoethyl]-N-ethoxyindole-6-carboximidoyl cyanide |
|---|---|
| PubChem CID | 123374240 |
| Molecular Formula | C28H26ClF2N5O4 |
| Molecular Weight | 570.00 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | 3-acetyl-1-[2-[(2S,4R)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-fluoropyrrolidin-1-yl]-2-oxoethyl]-N-ethoxyindole-6-carboximidoyl cyanide |
| SMILES | CCON=C(C#N)c1ccc2c(C(C)=O)cn(CC(=O)N3C[C@H](F)C[C@H]3C(=O)NCc3cccc(Cl)c3F)c2c1 |
| InChI | InChI=1S/C28H26ClF2N5O4/c1-3-40-34-23(11-32)17-7-8-20-21(16(2)37)14-35(24(20)9-17)15-26(38)36-13-19(30)10-25(36)28(39)33-12-18-5-4-6-22(29)27(18)31/h4-9,14,19,25H,3,10,12-13,15H2,1-2H3,(H,33,39)/t19-,25+/m1/s1 |
| InChIKey | XMBRGJKGICNVGF-CLOONOSVSA-N |
| XLogP | 4.16 |
| TPSA | 116.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.00 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|