C21H30O4 — CID 123375532
(10,13-dimethyl-6,16-dioxo-2,3,4,5,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate (PubChem CID 123375532) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (10,13-dimethyl-6,16-dioxo-2,3,4,5,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate.
| Compound Name | (10,13-dimethyl-6,16-dioxo-2,3,4,5,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate |
|---|---|
| PubChem CID | 123375532 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (10,13-dimethyl-6,16-dioxo-2,3,4,5,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate |
| SMILES | CC(=O)OC1CCC2(C)C(C1)C(=O)CC1C3CC(=O)CC3(C)CCC12 |
| InChI | InChI=1S/C21H30O4/c1-12(22)25-14-4-7-21(3)16-5-6-20(2)11-13(23)8-17(20)15(16)10-19(24)18(21)9-14/h14-18H,4-11H2,1-3H3 |
| InChIKey | JUWRQVXIGWBMIY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |