C17H20F2N4O2 — CID 123375584
4-[4-(4,4-difluorocyclohexyl)oxy-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-N-methylbut-2-enamide (PubChem CID 123375584) has the molecular formula C17H20F2N4O2 and a molecular weight of 350.37 g/mol. Its IUPAC name is 4-[4-(4,4-difluorocyclohexyl)oxy-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-N-methylbut-2-enamide.
| Compound Name | 4-[4-(4,4-difluorocyclohexyl)oxy-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 123375584 |
| Molecular Formula | C17H20F2N4O2 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 4-[4-(4,4-difluorocyclohexyl)oxy-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-N-methylbut-2-enamide |
| SMILES | CNC(=O)C=CCc1c[nH]c2ncnc(OC3CCC(F)(F)CC3)c12 |
| InChI | InChI=1S/C17H20F2N4O2/c1-20-13(24)4-2-3-11-9-21-15-14(11)16(23-10-22-15)25-12-5-7-17(18,19)8-6-12/h2,4,9-10,12H,3,5-8H2,1H3,(H,20,24)(H,21,22,23) |
| InChIKey | KMEDJERWKUSZEO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|