C9H15BN2O — CID 123378414
5-[methoxy(methyl)boranyl]-N,N-dimethylpyridin-2-amine (PubChem CID 123378414) has the molecular formula C9H15BN2O and a molecular weight of 178.04 g/mol. Its IUPAC name is 5-[methoxy(methyl)boranyl]-N,N-dimethylpyridin-2-amine.
| Compound Name | 5-[methoxy(methyl)boranyl]-N,N-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 123378414 |
| Molecular Formula | C9H15BN2O |
| Molecular Weight | 178.04 g/mol |
| Exact Mass | 178.13 |
| IUPAC Name | 5-[methoxy(methyl)boranyl]-N,N-dimethylpyridin-2-amine |
| SMILES | COB(C)c1ccc(N(C)C)nc1 |
| InChI | InChI=1S/C9H15BN2O/c1-10(13-4)8-5-6-9(11-7-8)12(2)3/h5-7H,1-4H3 |
| InChIKey | ABILVCQSHPBIBO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.04 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|