C20H28F3N — CID 123379472
5-ethyl-1,1,1-trifluoro-N,8-dimethyl-4-(4-methylphenyl)non-3-en-2-imine (PubChem CID 123379472) has the molecular formula C20H28F3N and a molecular weight of 339.45 g/mol. Its IUPAC name is 5-ethyl-1,1,1-trifluoro-N,8-dimethyl-4-(4-methylphenyl)non-3-en-2-imine.
| Compound Name | 5-ethyl-1,1,1-trifluoro-N,8-dimethyl-4-(4-methylphenyl)non-3-en-2-imine |
|---|---|
| PubChem CID | 123379472 |
| Molecular Formula | C20H28F3N |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 5-ethyl-1,1,1-trifluoro-N,8-dimethyl-4-(4-methylphenyl)non-3-en-2-imine |
| SMILES | CCC(CCC(C)C)C(=C/C(=N/C)C(F)(F)F)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H28F3N/c1-6-16(10-7-14(2)3)18(13-19(24-5)20(21,22)23)17-11-8-15(4)9-12-17/h8-9,11-14,16H,6-7,10H2,1-5H3/b18-13?,24-19- |
| InChIKey | HRHANUWAJOXVJX-TZSGLYMXSA-N |
| XLogP | 6.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|