C11H10F3N — CID 101372106
(E)-1,1,1-trifluoro-4-(4-methylphenyl)but-3-en-2-imine (PubChem CID 101372106) has the molecular formula C11H10F3N and a molecular weight of 213.20 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-4-(4-methylphenyl)but-3-en-2-imine.
| Compound Name | (E)-1,1,1-trifluoro-4-(4-methylphenyl)but-3-en-2-imine |
|---|---|
| PubChem CID | 101372106 |
| Molecular Formula | C11H10F3N |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | (E)-1,1,1-trifluoro-4-(4-methylphenyl)but-3-en-2-imine |
| SMILES | [H]/N=C(/C=C/c1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C11H10F3N/c1-8-2-4-9(5-3-8)6-7-10(15)11(12,13)14/h2-7,15H,1H3/b7-6+,15-10- |
| InChIKey | ZKSQMSXFQATYCE-ZWWGVYCGSA-N |
| XLogP | 3.59 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|