C9H7F3N2 — CID 14874565
1-(1-diazo-2,2,2-trifluoroethyl)-4-methylbenzene (PubChem CID 14874565) has the molecular formula C9H7F3N2 and a molecular weight of 200.16 g/mol. Its IUPAC name is 1-(1-diazo-2,2,2-trifluoroethyl)-4-methylbenzene.
| Compound Name | 1-(1-diazo-2,2,2-trifluoroethyl)-4-methylbenzene |
|---|---|
| PubChem CID | 14874565 |
| Molecular Formula | C9H7F3N2 |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 1-(1-diazo-2,2,2-trifluoroethyl)-4-methylbenzene |
| SMILES | Cc1ccc(C(=[N+]=[N-])C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7F3N2/c1-6-2-4-7(5-3-6)8(14-13)9(10,11)12/h2-5H,1H3 |
| InChIKey | GCYALTUVMDUVKD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|