C8H5ClF3N — CID 12653243
(Z)-N-chloro-2,2,2-trifluoro-1-phenylethanimine (PubChem CID 12653243) has the molecular formula C8H5ClF3N and a molecular weight of 207.58 g/mol. Its IUPAC name is (Z)-N-chloro-2,2,2-trifluoro-1-phenylethanimine.
| Compound Name | (Z)-N-chloro-2,2,2-trifluoro-1-phenylethanimine |
|---|---|
| PubChem CID | 12653243 |
| Molecular Formula | C8H5ClF3N |
| Molecular Weight | 207.58 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | (Z)-N-chloro-2,2,2-trifluoro-1-phenylethanimine |
| SMILES | FC(F)(F)/C(=N\Cl)c1ccccc1 |
| InChI | InChI=1S/C8H5ClF3N/c9-13-7(8(10,11)12)6-4-2-1-3-5-6/h1-5H/b13-7- |
| InChIKey | SMNSVPSNGNPGKH-QPEQYQDCSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.58 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|