About Trifluoro-methyl p-tolyl ketone hydrazone
Trifluoro-methyl p-tolyl ketone hydrazone (PubChem CID 129813900) has the molecular formula C9H9F3N2
and a molecular weight of 202.18 g/mol. Its IUPAC name is [2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]hydrazine.
Molecular Properties
| Compound Name | Trifluoro-methyl p-tolyl ketone hydrazone |
| PubChem CID | 129813900 |
| Molecular Formula | C9H9F3N2 |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | [2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]hydrazine |
| SMILES | CC1=CC=C(C=C1)C(=NN)C(F)(F)F |
| InChI | InChI=1S/C9H9F3N2/c1-6-2-4-7(5-3-6)8(14-13)9(10,11)12/h2-5H,13H2,1H3 |
| InChIKey | WXKHFNGJJABJAU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | 215 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze Trifluoro-methyl p-tolyl ketone hydrazone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Trifluoro-methyl p-tolyl ketone hydrazone?
The IUPAC name of Trifluoro-methyl p-tolyl ketone hydrazone (CID 129813900) is [2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]hydrazine.
What is the SMILES notation for Trifluoro-methyl p-tolyl ketone hydrazone?
The canonical SMILES for Trifluoro-methyl p-tolyl ketone hydrazone is CC1=CC=C(C=C1)C(=NN)C(F)(F)F.
What is the InChIKey of Trifluoro-methyl p-tolyl ketone hydrazone?
The InChIKey is WXKHFNGJJABJAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3N2/c1-6-2-4-7(5-3-6)8(14-13)9(10,11)12/h2-5H,13H2,1H3.
What are the key properties of Trifluoro-methyl p-tolyl ketone hydrazone?
Trifluoro-methyl p-tolyl ketone hydrazone has a molecular weight of 202.18 g/mol, XLogP of 3.00, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Trifluoro-methyl p-tolyl ketone hydrazone is sourced from PubChem (CID 129813900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).