C20H40O9P2S2 — CID 123379687
butyl 5,7-bis(dimethoxyphosphoryl)-7-ethoxycarbothioylsulfanyl-2,3-dimethylheptanoate (PubChem CID 123379687) has the molecular formula C20H40O9P2S2 and a molecular weight of 550.61 g/mol. Its IUPAC name is butyl 5,7-bis(dimethoxyphosphoryl)-7-ethoxycarbothioylsulfanyl-2,3-dimethylheptanoate.
| Compound Name | butyl 5,7-bis(dimethoxyphosphoryl)-7-ethoxycarbothioylsulfanyl-2,3-dimethylheptanoate |
|---|---|
| PubChem CID | 123379687 |
| Molecular Formula | C20H40O9P2S2 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | butyl 5,7-bis(dimethoxyphosphoryl)-7-ethoxycarbothioylsulfanyl-2,3-dimethylheptanoate |
| SMILES | CCCCOC(=O)C(C)C(C)CC(CC(SC(=S)OCC)P(=O)(OC)OC)P(=O)(OC)OC |
| InChI | InChI=1S/C20H40O9P2S2/c1-9-11-12-29-19(21)16(4)15(3)13-17(30(22,24-5)25-6)14-18(31(23,26-7)27-8)33-20(32)28-10-2/h15-18H,9-14H2,1-8H3 |
| InChIKey | BFACOFFVYPAXTH-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|