About 2-methyl-1-penta-1,3-dien-3-yl-1-prop-1-enylhydrazine
2-methyl-1-penta-1,3-dien-3-yl-1-prop-1-enylhydrazine (PubChem CID 123381625) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-methyl-1-penta-1,3-dien-3-yl-1-prop-1-enylhydrazine.
Molecular Properties
| Compound Name | 2-methyl-1-penta-1,3-dien-3-yl-1-prop-1-enylhydrazine |
| PubChem CID | 123381625 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2-methyl-1-penta-1,3-dien-3-yl-1-prop-1-enylhydrazine |
| SMILES | C=CC(=CC)N(C=CC)NC |
| InChI | InChI=1S/C9H16N2/c1-5-8-11(10-4)9(6-2)7-3/h5-8,10H,2H2,1,3-4H3 |
| InChIKey | UJLKQBZUZNUYFU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-penta-1,3-dien-3-yl-1-prop-1-enylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-penta-1,3-dien-3-yl-1-prop-1-enylhydrazine?
The IUPAC name of 2-methyl-1-penta-1,3-dien-3-yl-1-prop-1-enylhydrazine (CID 123381625) is 2-methyl-1-penta-1,3-dien-3-yl-1-prop-1-enylhydrazine.
What is the SMILES notation for 2-methyl-1-penta-1,3-dien-3-yl-1-prop-1-enylhydrazine?
The canonical SMILES for 2-methyl-1-penta-1,3-dien-3-yl-1-prop-1-enylhydrazine is C=CC(=CC)N(C=CC)NC.
What is the InChIKey of 2-methyl-1-penta-1,3-dien-3-yl-1-prop-1-enylhydrazine?
The InChIKey is UJLKQBZUZNUYFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-5-8-11(10-4)9(6-2)7-3/h5-8,10H,2H2,1,3-4H3.
What are the key properties of 2-methyl-1-penta-1,3-dien-3-yl-1-prop-1-enylhydrazine?
2-methyl-1-penta-1,3-dien-3-yl-1-prop-1-enylhydrazine has a molecular weight of 152.24 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-penta-1,3-dien-3-yl-1-prop-1-enylhydrazine is sourced from PubChem (CID 123381625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).