C8H12 — CID 123381875
6-methyltricyclo[2.2.1.01,3]heptane (PubChem CID 123381875) has the molecular formula C8H12 and a molecular weight of 108.18 g/mol. Its IUPAC name is 6-methyltricyclo[2.2.1.01,3]heptane.
| Compound Name | 6-methyltricyclo[2.2.1.01,3]heptane |
|---|---|
| PubChem CID | 123381875 |
| Molecular Formula | C8H12 |
| Molecular Weight | 108.18 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | 6-methyltricyclo[2.2.1.01,3]heptane |
| SMILES | CC1CC2CC13CC23 |
| InChI | InChI=1S/C8H12/c1-5-2-6-3-8(5)4-7(6)8/h5-7H,2-4H2,1H3 |
| InChIKey | CKHOITOVCXPYKL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |