C15H26 — CID 162269699
(2'R,5S,5'S)-2',5,5'-trimethylspiro[2,3,3a,4,5,6a-hexahydro-1H-pentalene-6,1'-cyclopentane] (PubChem CID 162269699) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is (2'R,5S,5'S)-2',5,5'-trimethylspiro[2,3,3a,4,5,6a-hexahydro-1H-pentalene-6,1'-cyclopentane].
| Compound Name | (2'R,5S,5'S)-2',5,5'-trimethylspiro[2,3,3a,4,5,6a-hexahydro-1H-pentalene-6,1'-cyclopentane] |
|---|---|
| PubChem CID | 162269699 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | (2'R,5S,5'S)-2',5,5'-trimethylspiro[2,3,3a,4,5,6a-hexahydro-1H-pentalene-6,1'-cyclopentane] |
| SMILES | C[C@@H]1CC[C@H](C)C12C1CCCC1C[C@@H]2C |
| InChI | InChI=1S/C15H26/c1-10-7-8-11(2)15(10)12(3)9-13-5-4-6-14(13)15/h10-14H,4-9H2,1-3H3/t10-,11+,12-,13?,14?,15?/m0/s1 |
| InChIKey | DCQRVOJGXAGABR-AGBFLVRWSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |