C15H28 — CID 162269378
(5S)-5-methyl-6,6-di(propan-2-yl)-2,3,3a,4,5,6a-hexahydro-1H-pentalene (PubChem CID 162269378) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is (5S)-5-methyl-6,6-di(propan-2-yl)-2,3,3a,4,5,6a-hexahydro-1H-pentalene.
| Compound Name | (5S)-5-methyl-6,6-di(propan-2-yl)-2,3,3a,4,5,6a-hexahydro-1H-pentalene |
|---|---|
| PubChem CID | 162269378 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | (5S)-5-methyl-6,6-di(propan-2-yl)-2,3,3a,4,5,6a-hexahydro-1H-pentalene |
| SMILES | CC(C)C1(C(C)C)C2CCCC2C[C@@H]1C |
| InChI | InChI=1S/C15H28/c1-10(2)15(11(3)4)12(5)9-13-7-6-8-14(13)15/h10-14H,6-9H2,1-5H3/t12-,13?,14?/m0/s1 |
| InChIKey | VOQPZMZTROTXAA-HSBZDZAISA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |