C18H32 — CID 162269078
(2'R,5S,5'S)-1,2,2',3,5,5'-hexamethylspiro[2,3,3a,4,5,6a-hexahydro-1H-pentalene-6,1'-cyclopentane] (PubChem CID 162269078) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is (2'R,5S,5'S)-1,2,2',3,5,5'-hexamethylspiro[2,3,3a,4,5,6a-hexahydro-1H-pentalene-6,1'-cyclopentane].
| Compound Name | (2'R,5S,5'S)-1,2,2',3,5,5'-hexamethylspiro[2,3,3a,4,5,6a-hexahydro-1H-pentalene-6,1'-cyclopentane] |
|---|---|
| PubChem CID | 162269078 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | (2'R,5S,5'S)-1,2,2',3,5,5'-hexamethylspiro[2,3,3a,4,5,6a-hexahydro-1H-pentalene-6,1'-cyclopentane] |
| SMILES | CC1C(C)C2C[C@H](C)C3(C2C1C)[C@H](C)CC[C@@H]3C |
| InChI | InChI=1S/C18H32/c1-10-7-8-11(2)18(10)12(3)9-16-14(5)13(4)15(6)17(16)18/h10-17H,7-9H2,1-6H3/t10-,11+,12-,13?,14?,15?,16?,17?,18?/m0/s1 |
| InChIKey | VPKDMYGWCIAVML-TYQZKHRCSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |