C10H18 — CID 91567702
1,2,4,6-tetramethylspiro[2.3]hexane (PubChem CID 91567702) has the molecular formula C10H18 and a molecular weight of 138.25 g/mol. Its IUPAC name is 1,2,4,6-tetramethylspiro[2.3]hexane.
| Compound Name | 1,2,4,6-tetramethylspiro[2.3]hexane |
|---|---|
| PubChem CID | 91567702 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | 1,2,4,6-tetramethylspiro[2.3]hexane |
| SMILES | CC1CC(C)C12C(C)C2C |
| InChI | InChI=1S/C10H18/c1-6-5-7(2)10(6)8(3)9(10)4/h6-9H,5H2,1-4H3 |
| InChIKey | UIJMLCZCAJJYPN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |