C13H22 — CID 123676036
2,4,10-trimethyltricyclo[5.3.0.01,5]decane (PubChem CID 123676036) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is 2,4,10-trimethyltricyclo[5.3.0.01,5]decane.
| Compound Name | 2,4,10-trimethyltricyclo[5.3.0.01,5]decane |
|---|---|
| PubChem CID | 123676036 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 2,4,10-trimethyltricyclo[5.3.0.01,5]decane |
| SMILES | CC1CC(C)C23C(C)CCC2CC13 |
| InChI | InChI=1S/C13H22/c1-8-6-10(3)13-9(2)4-5-11(13)7-12(8)13/h8-12H,4-7H2,1-3H3 |
| InChIKey | IRXAKAADAYVIHG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |