C10H16 — CID 123597135
7-methyltricyclo[4.3.0.01,3]nonane (PubChem CID 123597135) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is 7-methyltricyclo[4.3.0.01,3]nonane.
| Compound Name | 7-methyltricyclo[4.3.0.01,3]nonane |
|---|---|
| PubChem CID | 123597135 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 7-methyltricyclo[4.3.0.01,3]nonane |
| SMILES | CC1CCC23CC2CCC13 |
| InChI | InChI=1S/C10H16/c1-7-4-5-10-6-8(10)2-3-9(7)10/h7-9H,2-6H2,1H3 |
| InChIKey | JCPPBTJTTAFZAD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |