C11H18 — CID 163751027
(1S,2R,3S,7S)-1,2,7-trimethyltricyclo[3.2.1.03,8]octane (PubChem CID 163751027) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is (1S,2R,3S,7S)-1,2,7-trimethyltricyclo[3.2.1.03,8]octane.
| Compound Name | (1S,2R,3S,7S)-1,2,7-trimethyltricyclo[3.2.1.03,8]octane |
|---|---|
| PubChem CID | 163751027 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (1S,2R,3S,7S)-1,2,7-trimethyltricyclo[3.2.1.03,8]octane |
| SMILES | C[C@@H]1[C@@H]2CC3C[C@H](C)[C@]1(C)C32 |
| InChI | InChI=1S/C11H18/c1-6-4-8-5-9-7(2)11(6,3)10(8)9/h6-10H,4-5H2,1-3H3/t6-,7+,8?,9-,10?,11-/m0/s1 |
| InChIKey | LPZCPBTUIHXCEX-ABIJVSLOSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |