C10H20O5Si — CID 123382075
4-hydroxy-6-(hydroxymethyl)-5-methyl-3-trimethylsilyloxyoxan-2-one (PubChem CID 123382075) has the molecular formula C10H20O5Si and a molecular weight of 248.35 g/mol. Its IUPAC name is 4-hydroxy-6-(hydroxymethyl)-5-methyl-3-trimethylsilyloxyoxan-2-one.
| Compound Name | 4-hydroxy-6-(hydroxymethyl)-5-methyl-3-trimethylsilyloxyoxan-2-one |
|---|---|
| PubChem CID | 123382075 |
| Molecular Formula | C10H20O5Si |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 4-hydroxy-6-(hydroxymethyl)-5-methyl-3-trimethylsilyloxyoxan-2-one |
| SMILES | CC1C(CO)OC(=O)C(O[Si](C)(C)C)C1O |
| InChI | InChI=1S/C10H20O5Si/c1-6-7(5-11)14-10(13)9(8(6)12)15-16(2,3)4/h6-9,11-12H,5H2,1-4H3 |
| InChIKey | RWWZTISHQVERFN-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|